|
CAS#: 1023-91-2 Product: 3,3-Dimethyl-1-Phenyl-2-Benzofuran-1-Ol No suppilers available for the product. |
| Name | 3,3-Dimethyl-1-Phenyl-2-Benzofuran-1-Ol |
|---|---|
| Synonyms | 3,3-Dimethyl-1-Phenyl-Isobenzofuran-1-Ol; 3,3-Dimethyl-1-Phenyl-1-Isobenzofuranol; 1-Isobenzofuranol, 1,3-Dihydro-3,3-Dimethyl-1-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 |
| CAS Registry Number | 1023-91-2 |
| EINECS | 213-826-3 |
| SMILES | C1=CC=CC3=C1C(C2=CC=CC=C2)(OC3(C)C)O |
| InChI | 1S/C16H16O2/c1-15(2)13-10-6-7-11-14(13)16(17,18-15)12-8-4-3-5-9-12/h3-11,17H,1-2H3 |
| InChIKey | XNIDDCSFMRIISS-UHFFFAOYSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.065°C at 760 mmHg (Cal.) |
| Flash point | 171.706°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dimethyl-1-Phenyl-2-Benzofuran-1-Ol |