|
CAS#: 102358-22-5 Product: Deacetylpicraline 3,4,5-Trimethoxybenzoate No suppilers available for the product. |
| Name | Deacetylpicraline 3,4,5-Trimethoxybenzoate |
|---|---|
| Synonyms | Dap-Tmb; Deacetylpicraline 3,4,5-Trimethoxybenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C31H34N2O8 |
| Molecular Weight | 562.62 |
| CAS Registry Number | 102358-22-5 |
| SMILES | N14[C@@H]3[C@]27O[C@H]1C[C@@]2(C([C@@H](C3)\C(C4)=C/C)(C(OC)=O)COC(=O)C5=CC(=C(OC)C(=C5)OC)OC)C6=CC=CC=C6N7 |
| InChI | 1S/C31H34N2O8/c1-6-17-15-33-24-13-20(17)29(28(35)39-5,16-40-27(34)18-11-22(36-2)26(38-4)23(12-18)37-3)30-14-25(33)41-31(24,30)32-21-10-8-7-9-19(21)30/h6-12,20,24-25,32H,13-16H2,1-5H3/b17-6-/t20-,24-,25-,29?,30-,31-/m0/s1 |
| InChIKey | CLCDMQIWPVOTMQ-OTIPNRPASA-N |
| Density | 1.397g/cm3 (Cal.) |
|---|---|
| Boiling point | 664.894°C at 760 mmHg (Cal.) |
| Flash point | 355.915°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Deacetylpicraline 3,4,5-Trimethoxybenzoate |