|
CAS#: 102434-27-5 Product: 1-(2-Bromoethyl)-3-(4-Isopropoxy-1-Naphthalenemethyl)Urea No suppilers available for the product. |
| Name | 1-(2-Bromoethyl)-3-(4-Isopropoxy-1-Naphthalenemethyl)Urea |
|---|---|
| Synonyms | 3-(2-Bromoethyl)-1-[(4-Isopropoxy-1-Naphthyl)Methyl]Urea; 1-(2-Bromoethyl)-3-(4-Isopropoxy-1-Naphthalenemethyl)Urea; 3-(2-Bromoethyl)-1-(4-Isopropoxy-1-Naphthylmethyl)Urea |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21BrN2O2 |
| Molecular Weight | 365.27 |
| CAS Registry Number | 102434-27-5 |
| SMILES | C1=C(C2=C(C(=C1)OC(C)C)C=CC=C2)CNC(=O)NCCBr |
| InChI | 1S/C17H21BrN2O2/c1-12(2)22-16-8-7-13(11-20-17(21)19-10-9-18)14-5-3-4-6-15(14)16/h3-8,12H,9-11H2,1-2H3,(H2,19,20,21) |
| InChIKey | MKJFQRQGXIZLIA-UHFFFAOYSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.233°C at 760 mmHg (Cal.) |
| Flash point | 292.014°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Bromoethyl)-3-(4-Isopropoxy-1-Naphthalenemethyl)Urea |