|
CAS#: 102852-49-3 Product: Roritoxin B No suppilers available for the product. |
| Name | Roritoxin B |
|---|---|
| Synonyms | Roritoxin B; Vertisporin, 7',8'-Didehydro-2',3'-Epoxy-2',3'-Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C29H34O11 |
| Molecular Weight | 558.58 |
| CAS Registry Number | 102852-49-3 |
| SMILES | CC27C1(OC1)C8OC3C2(CCC(=C3)C)COC(=O)C4OC46C5OC(O)C(O)C5(OCC6)\C=C/C=C\C(OC7C8)=O |
| InChI | 1S/C29H34O11/c1-15-6-8-26-13-34-23(33)21-28(40-21)9-10-35-27(20(31)22(32)39-24(27)28)7-4-3-5-19(30)38-16-12-18(37-17(26)11-15)29(14-36-29)25(16,26)2/h3-5,7,11,16-18,20-22,24,31-32H,6,8-10,12-14H2,1-2H3/b5-3-,7-4- |
| InChIKey | WWNGAYLSKFTSBS-XDYPTIOJSA-N |
| Density | 1.514g/cm3 (Cal.) |
|---|---|
| Boiling point | 836.743°C at 760 mmHg (Cal.) |
| Flash point | 279.831°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Roritoxin B |