| Aronis | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (926) 578-0336 | |||
![]() |
rakishev@aronis.ru | |||
| Chemical manufacturer | ||||
| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | N-(2,6-Dichlorophenyl)Benzamide |
|---|---|
| Synonyms | benzamide, N-(2,6-dichlorophenyl)-; N-(2,6-dichlorophenyl)benzamide; BIM-0021100.P001 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9Cl2NO |
| Molecular Weight | 266.12 |
| CAS Registry Number | 10286-88-1 |
| SMILES | Clc2cccc(Cl)c2NC(=O)c1ccccc1 |
| InChI | 1S/C13H9Cl2NO/c14-10-7-4-8-11(15)12(10)16-13(17)9-5-2-1-3-6-9/h1-8H,(H,16,17) |
| InChIKey | KGDQECZKWWPUTK-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.536°C at 760 mmHg (Cal.) |
| Flash point | 133.141°C (Cal.) |
| Refractive index | 1.656 (Cal.) |
| SDS | Available |
|---|---|
| (1) | B. Thimme Gowda, Miroslav TokarcÃk, Jozef KozÃsek, B. P. Sowmya and Hartmut Fuess . N-(2,6-Dichlorophenyl)benzamide , Acta Cryst (2008). E64, o540Â Â |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(2,6-Dichlorophenyl)Benzamide |