|
CAS#: 102932-21-8 Product: 4-(4-Phenyldiazenylphenyl)Diazenylbenzoic Acid No suppilers available for the product. |
| Name | 4-(4-Phenyldiazenylphenyl)Diazenylbenzoic Acid |
|---|---|
| Synonyms | 4-(4-Phenylazophenyl)Azobenzoic Acid; 4-(4'-Azophenylazo)Benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 |
| CAS Registry Number | 102932-21-8 |
| SMILES | C1=CC(=CC=C1C(=O)O)N=NC2=CC=C(C=C2)N=NC3=CC=CC=C3 |
| InChI | 1S/C19H14N4O2/c24-19(25)14-6-8-16(9-7-14)21-23-18-12-10-17(11-13-18)22-20-15-4-2-1-3-5-15/h1-13H,(H,24,25) |
| InChIKey | SMHVWTMFOULFKA-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.15°C at 760 mmHg (Cal.) |
| Flash point | 294.988°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Phenyldiazenylphenyl)Diazenylbenzoic Acid |