|
CAS#: 103064-24-0 Product: 5,6,9,10-Tetrahydro-N-methyl-5,9-methanobenzocycloocten-11-amine No suppilers available for the product. |
| Name | 5,6,9,10-Tetrahydro-N-methyl-5,9-methanobenzocycloocten-11-amine |
|---|---|
| Synonyms | Org 6363 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 |
| CAS Registry Number | 103064-24-0 |
| SMILES | [C@H]23CC1=CC=CC=C1[C@@H](CC=C2)[C@H]3NC |
| InChI | 1S/C14H17N/c1-15-14-11-6-4-8-13(14)12-7-3-2-5-10(12)9-11/h2-7,11,13-15H,8-9H2,1H3/t11-,13-,14+/m1/s1 |
| InChIKey | ZQQHBIZNKVQDBS-BNOWGMLFSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.929°C at 760 mmHg (Cal.) |
| Flash point | 132.436°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,9,10-Tetrahydro-N-methyl-5,9-methanobenzocycloocten-11-amine |