|
CAS#: 1031-76-1 Product: 10,12-Dimethylbenzo[a]Acridine No suppilers available for the product. |
| Name | 10,12-Dimethylbenzo[a]Acridine |
|---|---|
| Synonyms | Benz(A)Acridine, 10,12-Dimethyl-; Dimethyl-10,12-Benz(A)Acridine; 10,12-Dimethylbenz(A)Acridine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H15N |
| Molecular Weight | 257.33 |
| CAS Registry Number | 1031-76-1 |
| SMILES | C4=CC3=NC2=CC=C1C=CC=CC1=C2C(=C3C=C4C)C |
| InChI | 1S/C19H15N/c1-12-7-9-17-16(11-12)13(2)19-15-6-4-3-5-14(15)8-10-18(19)20-17/h3-11H,1-2H3 |
| InChIKey | WMDJGDIOACZPGT-UHFFFAOYSA-N |
| Density | 1.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.938°C at 760 mmHg (Cal.) |
| Flash point | 208.664°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10,12-Dimethylbenzo[a]Acridine |