|
CAS#: 10311-74-7 Product: 1-Methyl-2-[(E)-2-(2-Methylphenyl)Ethenyl]Benzene No suppilers available for the product. |
| Name | 1-Methyl-2-[(E)-2-(2-Methylphenyl)Ethenyl]Benzene |
|---|---|
| Synonyms | 1-Methyl-2-[(E)-2-(2-Methylphenyl)Vinyl]Benzene; Tran 1,2-Di-O-Tolylethene; Benzene, 1,1'-(1,2-Ethenediyl)Bis*2-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 10311-74-7 |
| SMILES | C1=CC=CC(=C1/C=C/C2=C(C)C=CC=C2)C |
| InChI | 1S/C16H16/c1-13-7-3-5-9-15(13)11-12-16-10-6-4-8-14(16)2/h3-12H,1-2H3/b12-11+ |
| InChIKey | ARZIVALJTPLLHF-VAWYXSNFSA-N |
| Density | 1.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.358°C at 760 mmHg (Cal.) |
| Flash point | 149.934°C (Cal.) |
| (1) | Hans-Beat Bürgi. What we can learn about fast chemical processes from slow diffraction experiments, Faraday Discuss., 2003, 122, 41. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-2-[(E)-2-(2-Methylphenyl)Ethenyl]Benzene |