|
CAS#: 1033-99-4 Product: N,N-Dimethyl-2,2-Bis(Phenoxy)Acetamide No suppilers available for the product. |
| Name | N,N-Dimethyl-2,2-Bis(Phenoxy)Acetamide |
|---|---|
| Synonyms | N,N-Dimethyl-2,2-Bis(Phenoxy)Ethanamide; N,N-Dimethyl-2,2-Diphenoxyacetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 |
| CAS Registry Number | 1033-99-4 |
| EINECS | 213-852-5 |
| SMILES | C2=C(OC(C(N(C)C)=O)OC1=CC=CC=C1)C=CC=C2 |
| InChI | 1S/C16H17NO3/c1-17(2)15(18)16(19-13-9-5-3-6-10-13)20-14-11-7-4-8-12-14/h3-12,16H,1-2H3 |
| InChIKey | VAJOAIANUZSWJO-UHFFFAOYSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.955°C at 760 mmHg (Cal.) |
| Flash point | 222.901°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-2,2-Bis(Phenoxy)Acetamide |