|
CAS#: 10344-82-8 Product: Dimethyl-(3-Phenylpropyl)Azanium Chloride No suppilers available for the product. |
| Name | Dimethyl-(3-Phenylpropyl)Azanium Chloride |
|---|---|
| Synonyms | Dimethyl-(3-Phenylpropyl)Ammonium Chloride; N,N-Dimethyl-Gamma-Phenyl Propylamine Hydrochloride; Propylamine, N,N-Dimethyl-3-Phenyl-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18ClN |
| Molecular Weight | 199.72 |
| CAS Registry Number | 10344-82-8 |
| SMILES | C1=C(CCC[NH+](C)C)C=CC=C1.[Cl-] |
| InChI | 1S/C11H17N.ClH/c1-12(2)10-6-9-11-7-4-3-5-8-11;/h3-5,7-8H,6,9-10H2,1-2H3;1H |
| InChIKey | VEZGIHXTYFPGNA-UHFFFAOYSA-N |
| Boiling point | 226.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 82.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl-(3-Phenylpropyl)Azanium Chloride |