|
CAS#: 10356-92-0 Product: N-Methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-Pentahydroxyhexyl]Nitrous Amide No suppilers available for the product. |
| Name | N-Methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-Pentahydroxyhexyl]Nitrous Amide |
|---|---|
| Synonyms | 1-N-Methyl-N-Nitrosoamino-1-Desoxy-D-Glucit [German]; Glucitol, 1-Deoxy-1-(Methylnitrosamino)-, D-; 1-(N-Methyl-N-Nitrosamino)-1-Deoxy-D-Glucitol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H16N2O6 |
| Molecular Weight | 224.21 |
| CAS Registry Number | 10356-92-0 |
| SMILES | [C@@H](CO)([C@H]([C@@H]([C@H](CN(C)N=O)O)O)O)O |
| InChI | 1S/C7H16N2O6/c1-9(8-15)2-4(11)6(13)7(14)5(12)3-10/h4-7,10-14H,2-3H2,1H3/t4-,5+,6+,7+/m0/s1 |
| InChIKey | VLGVGLCWLGEFMR-BDVNFPICSA-N |
| Density | 1.561g/cm3 (Cal.) |
|---|---|
| Boiling point | 619.19°C at 760 mmHg (Cal.) |
| Flash point | 328.275°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-Pentahydroxyhexyl]Nitrous Amide |