Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (732) 355-9920 | |||
|
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Vitas-M | Russian Federation | Inquire | ||
|---|---|---|---|---|
|
+7 (906) 781-2021 | |||
|
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 2-[2,4-Bis(2-Methyl-2-Butanyl)Phenoxy]-N-(4-{[(4-Chloro-3-Cyanophenyl)Carbamoyl]Amino}-3-Hydroxyphenyl)Hexanamide |
|---|---|
| Synonyms | 2-[2,4-bi |
| Molecular Structure | ![CAS#: 103576-30-3, 2-[2,4-Bis(2-Methyl-2-Butanyl)Phenoxy]-N-(4-{[(4-Chloro-3-Cyanophenyl)Carbamoyl]Amino}-3-Hydroxyphenyl)Hexanamide](/moreStructures/103576-30-3.gif) |
| Molecular Formula | C36H45ClN4O4 |
| Molecular Weight | 633.22 |
| CAS Registry Number | 103576-30-3 |
| SMILES | N#Cc1cc(ccc1Cl)NC(=O)Nc3ccc(NC(=O)C(Oc2ccc(cc2C(C)(C)CC)C(C)(C)CC)CCCC)cc3O |
| InChI | rd-copy-button" onmouseover="ClipboardCopyInit(this, |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 704.829°C at 760 mmHg (Cal.) |
| Flash point | 380.067°C (Cal.) |
| Refractive index | 1.598 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2,4-Bis(2-Methyl-2-Butanyl)Phenoxy]-N-(4-{[(4-Chloro-3-Cyanophenyl)Carbamoyl]Amino}-3-Hydroxyphenyl)Hexanamide |