|
CAS#: 10359-57-6 Product: 3-Methyl-3-Nitro-1-Oxothietane-2,4-Diol No suppilers available for the product. |
| Name | 3-Methyl-3-Nitro-1-Oxothietane-2,4-Diol |
|---|---|
| Synonyms | 3-Methyl-3-Nitro-1-Oxo-Thietane-2,4-Diol; 1-Keto-3-Methyl-3-Nitro-Thietane-2,4-Diol; 2-Nitro-2-Methyl Trimethylene Sulfite |
| Molecular Structure | ![]() |
| Molecular Formula | C4H7NO5S |
| Molecular Weight | 181.16 |
| CAS Registry Number | 10359-57-6 |
| SMILES | CC1([N+]([O-])=O)C([S](=O)C1O)O |
| InChI | 1S/C4H7NO5S/c1-4(5(8)9)2(6)11(10)3(4)7/h2-3,6-7H,1H3 |
| InChIKey | QYTRQJVRZWHUCU-UHFFFAOYSA-N |
| Density | 1.881g/cm3 (Cal.) |
|---|---|
| Boiling point | 561.574°C at 760 mmHg (Cal.) |
| Flash point | 293.43°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-3-Nitro-1-Oxothietane-2,4-Diol |