P and M Invest Ltd. | Russian Federation | Inquire | ||
---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
Chemical manufacturer | ||||
Name | 1,1,1,2,3,3,3-Heptafluoro-2-(1,2,2-Trifluoroethenoxy)Propane |
---|---|
Synonyms | 1,1,2-Trifluoro-2-[1,2,2,2-Tetrafluoro-1-(Trifluoromethyl)Ethoxy]Ethylene; 1,1,1,2,3,3,3-Heptafluoro-2-((Trifluorovinyl)Oxy)Propane |
Molecular Structure | ![]() |
Molecular Formula | C5F10O |
Molecular Weight | 266.04 |
CAS Registry Number | 10372-98-2 |
EINECS | 233-813-6 |
SMILES | C(OC(C(F)(F)F)(C(F)(F)F)F)(=C(F)F)F |
InChI | 1S/C5F10O/c6-1(7)2(8)16-3(9,4(10,11)12)5(13,14)15 |
InChIKey | BJURIXFNPBYZNB-UHFFFAOYSA-N |
Density | 1.61g/cm3 (Cal.) |
---|---|
Boiling point | 62.405°C at 760 mmHg (Cal.) |
Flash point | -3.479°C (Cal.) |
Market Analysis Reports |
List of Reports Available for 1,1,1,2,3,3,3-Heptafluoro-2-(1,2,2-Trifluoroethenoxy)Propane |