Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Butyl(Dimethyl)(Trimethylstannyl)Silane |
|---|---|
| Synonyms | Trimethyl stannyl butyl dimethyl silane; Trimethylstannylbutyldimethylsilane; Triphenylstannyl butyl dimethyl silane |
| Molecular Structure |  |
| Molecular Formula | C9H24SiSn |
| Molecular Weight | 279.08 |
| CAS Registry Number | 103731-29-9 |
| SMILES | CCCC[Si](C)(C)[Sn](C)(C)C |
| InChI | 1S/C6H15Si.3CH3.Sn/c1-4-5-6-7(2)3;;;;/h4-6H2,1-3H3;3*1H3; |
| InChIKey | VMPWKRWEAAWHRD-UHFFFAOYSA-N |
| Boiling point | 226.4969-229.2503°C (Expl.) |
|---|---|
| 209.981°C at 760 mmHg (Cal.) | |
| Flash point | 80.794°C (Cal.) |
| Refractive index | (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Butyl(Dimethyl)(Trimethylstannyl)Silane |