|
CAS#: 10380-41-3 Product: 2-Cyano-3,3-Diphenylacrylic Acid No suppilers available for the product. |
| Name | 2-Cyano-3,3-Diphenylacrylic Acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.26 |
| CAS Registry Number | 10380-41-3 |
| SMILES | N#C/C(C(=O)O)=C(/c1ccccc1)c2ccccc2 |
| InChI | 1S/C16H11NO2/c17-11-14(16(18)19)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,(H,18,19) |
| InChIKey | VSXIZXFGQGKZQG-UHFFFAOYSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.573°C at 760 mmHg (Cal.) |
| Flash point | 181.545°C (Cal.) |
| Refractive index | 1.625 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Cyano-3,3-Diphenylacrylic Acid |