|
CAS#: 103810-85-1 Product: 4-(Acetylamino)Phenylretinoate No suppilers available for the product. |
| Name | 4-(Acetylamino)Phenylretinoate |
|---|---|
| Synonyms | (2Z,4E,6Z,8E)-3,7-Dimethyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenoic Acid (4-Acetamidophenyl) Ester; 4-(Acetylamino)Phenylretinoate; Bmy 30123 |
| Molecular Structure | ![]() |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 |
| CAS Registry Number | 103810-85-1 |
| SMILES | C2=C(OC(=O)/C=C(\C=C\C=C(/C=C/C1=C(CCCC1(C)C)C)C)C)C=CC(=C2)NC(=O)C |
| InChI | 1S/C28H35NO3/c1-20(12-17-26-22(3)11-8-18-28(26,5)6)9-7-10-21(2)19-27(31)32-25-15-13-24(14-16-25)29-23(4)30/h7,9-10,12-17,19H,8,11,18H2,1-6H3,(H,29,30)/b10-7+,17-12+,20-9-,21-19- |
| InChIKey | LQBHPDDJEMOJQA-GLKGMVBCSA-N |
| Density | 1.081g/cm3 (Cal.) |
|---|---|
| Boiling point | 623.917°C at 760 mmHg (Cal.) |
| Flash point | 331.133°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Acetylamino)Phenylretinoate |