Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 3,7-Dimethyl-2,6-Octadienyl 2,3-Dimethylcrotonate |
|---|---|
| Synonyms | 2,3-Dimethylbut-2-Enoic Acid [(2E)-3,7-Dimethylocta-2,6-Dienyl] Ester; 2-Butenoic Acid, 2,3-Dimethyl-, 3,7-Dimethyl-2,6-Octadienyl Ester, (E)-; 3,7-Dimethyl-2,6-Octadienyl 2,3-Dimethylcrotonate |
| Molecular Structure |  |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 |
| CAS Registry Number | 10402-48-9 |
| EINECS | 233-870-7 |
| SMILES | C(OC(C(=C(C)C)C)=O)\C=C(\CCC=C(C)C)C |
| InChI | 1S/C16H26O2/c1-12(2)8-7-9-14(5)10-11-18-16(17)15(6)13(3)4/h8,10H,7,9,11H2,1-6H3/b14-10+ |
| InChIKey | GLMOJOJHHPDUHX-GXDHUFHOSA-N |
| Density | 0.907g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.737°C at 760 mmHg (Cal.) |
| Flash point | 163.523°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Dimethyl-2,6-Octadienyl 2,3-Dimethylcrotonate |