|
CAS#: 104114-70-7 Product: Bromo[(1R,2S,3R,5R)-2,6,6-Trimethylbicyclo[3.1.1]Hept-3-Yl][(1S,2R,3S,5S)-2,6,6-Trimethylbicyclo[3.1.1]Hept-3-Yl]Borane No suppilers available for the product. |
| Name | Bromo[(1R,2S,3R,5R)-2,6,6-Trimethylbicyclo[3.1.1]Hept-3-Yl][(1S,2R,3S,5S)-2,6,6-Trimethylbicyclo[3.1.1]Hept-3-Yl]Borane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H34BBr |
| Molecular Weight | 365.20 |
| CAS Registry Number | 104114-70-7 |
| SMILES | C[C@@H]3[C@H]4C[C@@H](C[C@H]3B(Br)[C@H]1C[C@H]2C[C@@H]([C@@H]1C)C2(C)C)C4(C)C |
| InChI | 1S/C20H34BBr/c1-11-15-7-13(19(15,3)4)9-17(11)21(22)18-10-14-8-16(12(18)2)20(14,5)6/h11-18H,7-10H2,1-6H3/t11-,12+,13+,14-,15-,16+,17-,18+ |
| InChIKey | FKBAVEASVZAXFW-MJGPRRAXSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.364°C at 760 mmHg (Cal.) |
| Flash point | 179.605°C (Cal.) |
| Refractive index | 1.515 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bromo[(1R,2S,3R,5R)-2,6,6-Trimethylbicyclo[3.1.1]Hept-3-Yl][(1S,2R,3S,5S)-2,6,6-Trimethylbicyclo[3.1.1]Hept-3-Yl]Borane |