|
CAS#: 10422-66-9 Product: Bis(3-Hydroxy-P-Tolylammonium) Sulphate No suppilers available for the product. |
| Name | Bis(3-Hydroxy-P-Tolylammonium) Sulphate |
|---|---|
| Synonyms | 5-Amino-2-Methyl-Phenol; Sulfuric Acid; Phenol, 5-Amino-2-Methyl-, Sulfate (2:1) (Salt); P-Amino-O-Cresol Hemisulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.38 |
| CAS Registry Number | 10422-66-9 |
| EINECS | 233-901-4 |
| SMILES | O=[S](=O)(O)O.C1=C(O)C(=CC=C1N)C.C2=C(O)C(=CC=C2N)C |
| InChI | 1S/2C7H9NO.H2O4S/c2*1-5-2-3-6(8)4-7(5)9;1-5(2,3)4/h2*2-4,9H,8H2,1H3;(H2,1,2,3,4) |
| InChIKey | DFXDIGLMOMCJFC-UHFFFAOYSA-N |
| Boiling point | 268.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 116.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(3-Hydroxy-P-Tolylammonium) Sulphate |