|
CAS#: 10425-83-9 Product: 3,3,4,5,7-Pentamethyl-1-Indanone No suppilers available for the product. |
| Name | 3,3,4,5,7-Pentamethyl-1-Indanone |
|---|---|
| Synonyms | 3,3,4,5,7-Pentamethyl-1-indanone # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.29 |
| CAS Registry Number | 10425-83-9 |
| SMILES | O=C2c1c(cc(c(c1C(C2)(C)C)C)C)C |
| InChI | 1S/C14H18O/c1-8-6-9(2)12-11(15)7-14(4,5)13(12)10(8)3/h6H,7H2,1-5H3 |
| InChIKey | DZDMYFGMAJZKAN-UHFFFAOYSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.591°C at 760 mmHg (Cal.) |
| Flash point | 138.984°C (Cal.) |
| Refractive index | 1.529 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,4,5,7-Pentamethyl-1-Indanone |