|
CAS#: 10435-68-4 Product: 2,3,4-Trimethylindeno[2,1-b]pyran No suppilers available for the product. |
| Name | 2,3,4-Trimethylindeno[2,1-b]pyran |
|---|---|
| Synonyms | 4,5,6-Trimethyl-2,3-Benzoxalene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 |
| CAS Registry Number | 10435-68-4 |
| SMILES | C1=CC=C3C(=C1)C2=C(C(=C(OC2=C3)C)C)C |
| InChI | 1S/C15H14O/c1-9-10(2)15-13-7-5-4-6-12(13)8-14(15)16-11(9)3/h4-8H,1-3H3 |
| InChIKey | RQRZTEYZJZHKQR-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.114°C at 760 mmHg (Cal.) |
| Flash point | 181.581°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4-Trimethylindeno[2,1-b]pyran |