|
CAS#: 104453-35-2 Product: Cycloheptane; Hafnium; 1,2,3,4,5-Pentamethylcyclopenta-1,3-Diene No suppilers available for the product. |
| Name | Cycloheptane; Hafnium; 1,2,3,4,5-Pentamethylcyclopenta-1,3-Diene |
|---|---|
| Synonyms | Hafnium, |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22Hf |
| Molecular Weight | 404.85 |
| CAS Registry Number | 104453-35-2 |
| SMILES | [Hf].c1([c-](c(c(c1C)C)C)C)C.[CH-]1[CH-][CH-][CH-][CH-][CH-][CH-]1 |
| InChI | 1S/C10H15.C7H7.Hf/c1-6-7(2)9(4)10(5)8(6)3;1-2-4-6-7-5-3-1;/h1-5H3;1-7H;/q-1;-7; |
| InChIKey | OILBQJQBPBAFSX-UHFFFAOYSA-N |
| Boiling point | 170.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 44.4°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cycloheptane; Hafnium; 1,2,3,4,5-Pentamethylcyclopenta-1,3-Diene |