|
CAS#: 10448-50-7 Product: Ethyl Triphosphate No suppilers available for the product. |
| Name | Ethyl Triphosphate |
|---|---|
| Synonyms | Phosphoric Acid Bis(Diethoxyphosphoryl) Ethyl Ester; Ethyl Triphosphate, (Eto)5P3o5; Nsc70162 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H25O10P3 |
| Molecular Weight | 398.22 |
| CAS Registry Number | 10448-50-7 |
| SMILES | C(O[P](O[P](OCC)(OCC)=O)(O[P](OCC)(OCC)=O)=O)C |
| InChI | 1S/C10H25O10P3/c1-6-14-21(11,15-7-2)19-23(13,18-10-5)20-22(12,16-8-3)17-9-4/h6-10H2,1-5H3 |
| InChIKey | HLUKKPLFWYYSGY-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.524°C at 760 mmHg (Cal.) |
| Flash point | 201.715°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl Triphosphate |