|
CAS#: 104535-31-1 Product: 1-(2,5-Diamino-3-Nitrophenyl)Propan-2-Ol No suppilers available for the product. |
| Name | 1-(2,5-Diamino-3-Nitrophenyl)Propan-2-Ol |
|---|---|
| Synonyms | 1-(2,5-Diamino-3-Nitro-Phenyl)Propan-2-Ol; 4-Amino-3-Nitro-5-Beta-Hydroxypropylaniline |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 |
| CAS Registry Number | 104535-31-1 |
| SMILES | C1=C([N+]([O-])=O)C(=C(C=C1N)CC(O)C)N |
| InChI | 1S/C9H13N3O3/c1-5(13)2-6-3-7(10)4-8(9(6)11)12(14)15/h3-5,13H,2,10-11H2,1H3 |
| InChIKey | MXOCSXVBYBYNOZ-UHFFFAOYSA-N |
| Density | 1.38g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.821°C at 760 mmHg (Cal.) |
| Flash point | 236.73°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,5-Diamino-3-Nitrophenyl)Propan-2-Ol |