|
CAS#: 104594-69-6 Product: Galangin-5-Methylether No suppilers available for the product. |
| Name | Galangin-5-Methylether |
|---|---|
| Synonyms | 3,7-Dihydroxy-5-Methoxy-2-Phenyl-Chromen-4-One; 3,7-Dihydroxy-5-Methoxy-2-Phenyl-4-Chromenone; 3,7-Dihydroxy-5-Methoxy-2-Phenyl-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 |
| CAS Registry Number | 104594-69-6 |
| SMILES | C2=C(O)C=C1OC(=C(O)C(=O)C1=C2OC)C3=CC=CC=C3 |
| InChI | 1S/C16H12O5/c1-20-11-7-10(17)8-12-13(11)14(18)15(19)16(21-12)9-5-3-2-4-6-9/h2-8,17,19H,1H3 |
| InChIKey | LDRJANCOJOKOPS-UHFFFAOYSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| Boiling point | 539.274°C at 760 mmHg (Cal.) |
| Flash point | 206.756°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Galangin-5-Methylether |