Online Database of Chemicals from Around the World
|
CAS#: 1046-28-2 Product: 17alpha-Methylprogesterone No suppilers available for the product. |
| Name | 17alpha-Methylprogesterone |
|---|---|
| Synonyms | (8R,9S,10R,13S,14S,17S)-17-Ethanoyl-10,13,17-Trimethyl-2,6,7,8,9,11,12,14,15,16-Decahydro-1H-Cyclopenta[A]Phenanthren-3-One; 17-Methylpregn-4-Ene-3,20-Dione; 17-Methylprogesterone |
| Molecular Structure |  |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.49 |
| CAS Registry Number | 1046-28-2 |
| SMILES | [C@H]24[C@H]1[C@@]([C@](C(C)=O)(C)CC1)(CC[C@@H]2[C@@]3(C(=CC(=O)CC3)CC4)C)C |
| InChI | 1S/C22H32O2/c1-14(23)21(3)11-9-19-17-6-5-15-13-16(24)7-10-20(15,2)18(17)8-12-22(19,21)4/h13,17-19H,5-12H2,1-4H3/t17-,18+,19+,20+,21-,22+/m1/s1 |
| InChIKey | UFIQEZHBGZCWRS-QZKGNRECSA-N |
| Density | 1.077g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.521°C at 760 mmHg (Cal.) |
| Flash point | 167.515°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17alpha-Methylprogesterone |