|
CAS#: 10468-60-7 Product: 3,5,8-Trimethyl-3,4-Dihydro-1(2H)-Naphthalenone No suppilers available for the product. |
| Name | 3,5,8-Trimethyl-3,4-Dihydro-1(2H)-Naphthalenone |
|---|---|
| Synonyms | 3,5,8-Trimethyl-3,4-dihydro-1(2H)-naphthalenone #; 3,6,8-Trimethyl-1-tetralone |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 |
| CAS Registry Number | 10468-60-7 |
| SMILES | O=C2c1c(ccc(c1CC(C)C2)C)C |
| InChI | 1S/C13H16O/c1-8-6-11-9(2)4-5-10(3)13(11)12(14)7-8/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | NCKPIRHHNXSPKV-UHFFFAOYSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.058°C at 760 mmHg (Cal.) |
| Flash point | 136.192°C (Cal.) |
| Refractive index | 1.533 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,8-Trimethyl-3,4-Dihydro-1(2H)-Naphthalenone |