|
CAS#: 104693-32-5 Product: (Z)-7-[(4S,5R)-2,2-Dimethyl-4-Phenyl-1,3-Dioxan-5-Yl]Hept-5-Enoic Acid No suppilers available for the product. |
| Name | (Z)-7-[(4S,5R)-2,2-Dimethyl-4-Phenyl-1,3-Dioxan-5-Yl]Hept-5-Enoic Acid |
|---|---|
| Synonyms | 5-Heptenoic Acid, 7-(2,2-Dimethyl-4-Phenyl-1,3-Dioxan-5-Yl)-, (4Alpha,5Alpha(Z))-; 7-(2,2-Dimethyl-4-Phenyl-1,3-Dioxan-5-Yl)Heptenoic Acid; 7-Ddpdha |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 |
| CAS Registry Number | 104693-32-5 |
| SMILES | [C@@H]1(OC(OC[C@H]1C\C=C/CCCC(=O)O)(C)C)C2=CC=CC=C2 |
| InChI | 1S/C19H26O4/c1-19(2)22-14-16(12-6-3-4-9-13-17(20)21)18(23-19)15-10-7-5-8-11-15/h3,5-8,10-11,16,18H,4,9,12-14H2,1-2H3,(H,20,21)/b6-3-/t16-,18-/m1/s1 |
| InChIKey | NCTKBYPUWBMEBQ-CDITXYPMSA-N |
| Density | 1.063g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.651°C at 760 mmHg (Cal.) |
| Flash point | 161.02°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-7-[(4S,5R)-2,2-Dimethyl-4-Phenyl-1,3-Dioxan-5-Yl]Hept-5-Enoic Acid |