|
CAS#: 104721-33-7 Product: Methyl 3-Phenyl-5-(Trifluoromethyl)-1,2-Oxazole-4-Carboxylate No suppilers available for the product. |
| Name | Methyl 3-Phenyl-5-(Trifluoromethyl)-1,2-Oxazole-4-Carboxylate |
|---|---|
| Synonyms | methyl 3-phenyl-5-trifluoromethyl-4-isoxazolcarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8F3NO3 |
| Molecular Weight | 271.19 |
| CAS Registry Number | 104721-33-7 |
| SMILES | COC(=O)c1c(noc1C(F)(F)F)c2ccccc2 |
| InChI | 1S/C12H8F3NO3/c1-18-11(17)8-9(7-5-3-2-4-6-7)16-19-10(8)12(13,14)15/h2-6H,1H3 |
| InChIKey | AULRMNJYLKKYAB-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.387°C at 760 mmHg (Cal.) |
| Flash point | 188.69°C (Cal.) |
| Refractive index | 1.486 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-Phenyl-5-(Trifluoromethyl)-1,2-Oxazole-4-Carboxylate |