| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-Methoxy-2,2'-Bipyrrole-5-Carboxaldehyde |
|---|---|
| Synonyms | 3-Methoxy-5-(1H-Pyrrol-2-Yl)-1H-Pyrrole-2-Carboxaldehyde; (2,2'-Bi-1H-Pyrrole)-5-Carboxaldehyde, 4-Methoxy-; 4-Methoxy-2,2'-Bipyrrole-5-Carboxaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 |
| CAS Registry Number | 10476-41-2 |
| SMILES | C1=C([NH]C(=C1OC)C=O)C2=CC=C[NH]2 |
| InChI | 1S/C10H10N2O2/c1-14-10-5-8(12-9(10)6-13)7-3-2-4-11-7/h2-6,11-12H,1H3 |
| InChIKey | MQCYELLGZFKAFD-UHFFFAOYSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.331°C at 760 mmHg (Cal.) |
| Flash point | 233.41°C (Cal.) |
| (1) | Chawrai Suresh R.. Chemoenzymatic synthesis of prodigiosin analogues—exploring the substrate specificity of PigC, Chemical Communications, 2008 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Methoxy-2,2'-Bipyrrole-5-Carboxaldehyde |