|
CAS#: 10484-48-7 Product: 4-(Benzoyldioxy)-4-Oxobutyric Acid No suppilers available for the product. |
| Name | 4-(Benzoyldioxy)-4-Oxobutyric Acid |
|---|---|
| Synonyms | 4-(Benzoylperoxy)-4-Oxo-Butanoic Acid; 4-Oxo-4-(Oxo-Phenylmethyl)Dioxybutanoic Acid; 4-(Benzoylperoxy)-4-Keto-Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.20 |
| CAS Registry Number | 10484-48-7 |
| EINECS | 233-997-8 |
| SMILES | C1=C(C(OOC(=O)CCC(=O)O)=O)C=CC=C1 |
| InChI | 1S/C11H10O6/c12-9(13)6-7-10(14)16-17-11(15)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13) |
| InChIKey | QUZPSMZNTIBYAS-UHFFFAOYSA-N |
| Density | 1.361g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.435°C at 760 mmHg (Cal.) |
| Flash point | 154.156°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Benzoyldioxy)-4-Oxobutyric Acid |