|
CAS#: 10486-47-2 Product: 4-Amino-2,3,6-Trimethylphenol Hydrochloride No suppilers available for the product. |
| Name | 4-Amino-2,3,6-Trimethylphenol Hydrochloride |
|---|---|
| Synonyms | 4-Amino-2,3,6-Trimethyl-Phenol Hydrochloride; Phenol, 4-Amino-2,3,6-Trimethyl-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 |
| CAS Registry Number | 10486-47-2 |
| EINECS | 234-007-7 |
| SMILES | [H+].C1=C(C(=C(C(=C1N)C)C)O)C.[Cl-] |
| InChI | 1S/C9H13NO.ClH/c1-5-4-8(10)6(2)7(3)9(5)11;/h4,11H,10H2,1-3H3;1H |
| InChIKey | BQWKRBMMHCSQOJ-UHFFFAOYSA-N |
| Boiling point | 299.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 135.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-2,3,6-Trimethylphenol Hydrochloride |