|
CAS#: 104864-90-6 Product: 2-Methyl-4-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)-4-Penten-1-Ol No suppilers available for the product. |
| Name | 2-Methyl-4-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)-4-Penten-1-Ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 |
| CAS Registry Number | 104864-90-6 |
| SMILES | CC1(C)C(/C)=C\CC1C(=C)CC(C)CO |
| InChI | 1S/C14H24O/c1-10(9-15)8-11(2)13-7-6-12(3)14(13,4)5/h6,10,13,15H,2,7-9H2,1,3-5H3 |
| InChIKey | DGHXZJZALPECTJ-UHFFFAOYSA-N |
| Density | 0.901g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.278°C at 760 mmHg (Cal.) |
| Flash point | 108.076°C (Cal.) |
| Refractive index | 1.478 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)-4-Penten-1-Ol |