|
CAS#: 10500-82-0 Product: Famotine Hydrochloride No suppilers available for the product. |
| Name | Famotine Hydrochloride |
|---|---|
| Synonyms | Nsc139353; Uk-2054; D04125 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 |
| CAS Registry Number | 10500-82-0 |
| SMILES | [H+].C2=C1CCN=C(C1=CC=C2)COC3=CC=C(Cl)C=C3.[Cl-] |
| InChI | 1S/C16H14ClNO.ClH/c17-13-5-7-14(8-6-13)19-11-16-15-4-2-1-3-12(15)9-10-18-16;/h1-8H,9-11H2;1H |
| InChIKey | XWPQCMLTRJWFKB-UHFFFAOYSA-N |
| Boiling point | 411.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 202.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Famotine Hydrochloride |