|
CAS#: 105049-03-4 Product: N-(2,4,6-Trinitrophenyl)-1,2-Benzenediamine No suppilers available for the product. |
| Name | N-(2,4,6-Trinitrophenyl)-1,2-Benzenediamine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H9N5O6 |
| Molecular Weight | 319.23 |
| CAS Registry Number | 105049-03-4 |
| SMILES | [O-][N+](=O)c1c(c([N+]([O-])=O)cc([N+]([O-])=O)c1)Nc2ccccc2N |
| InChI | 1S/C12H9N5O6/c13-8-3-1-2-4-9(8)14-12-10(16(20)21)5-7(15(18)19)6-11(12)17(22)23/h1-6,14H,13H2 |
| InChIKey | PBBLSELQFQHTAB-UHFFFAOYSA-N |
| Density | 1.652g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.299°C at 760 mmHg (Cal.) |
| Flash point | 228.552°C (Cal.) |
| Refractive index | 1.76 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,4,6-Trinitrophenyl)-1,2-Benzenediamine |