|
CAS#: 105229-76-3 Product: O-[(3S)-8-Amino-8-Oxo-3-Sulfanyloctyl] Ethanethioate No suppilers available for the product. |
| Name | O-[(3S)-8-Amino-8-Oxo-3-Sulfanyloctyl] Ethanethioate |
|---|---|
| Synonyms | O-[(3S)-8-Amino-8-Oxo-3-Sulfanyl-Octyl] Ethanethioate; Ethanethioic Acid O-[(3S)-8-Amino-3-Mercapto-8-Oxooctyl] Ester; Ethanethioic Acid O-[(3S)-8-Amino-8-Keto-3-Mercapto-Octyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H19NO2S2 |
| Molecular Weight | 249.39 |
| CAS Registry Number | 105229-76-3 |
| SMILES | [C@@H](CCOC(C)=S)(CCCCC(=O)N)S |
| InChI | 1S/C10H19NO2S2/c1-8(14)13-7-6-9(15)4-2-3-5-10(11)12/h9,15H,2-7H2,1H3,(H2,11,12)/t9-/m0/s1 |
| InChIKey | ARZXIUWCNWKTNV-VIFPVBQESA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.424°C at 760 mmHg (Cal.) |
| Flash point | 218.951°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-[(3S)-8-Amino-8-Oxo-3-Sulfanyloctyl] Ethanethioate |