|
CAS#: 105372-81-4 Product: 3,5-Dibromo-2',3',5',7',8',9'-hexahydro-Spiro[2,5-cyclohexadiene-1,10'(6'H)-pyrrolo[4,3,2-de][1,7]phenanthroline]-4,6'-dione No suppilers available for the product. |
| Name | 3,5-Dibromo-2',3',5',7',8',9'-hexahydro-Spiro[2,5-cyclohexadiene-1,10'(6'H)-pyrrolo[4,3,2-de][1,7]phenanthroline]-4,6'-dione |
|---|---|
| Synonyms | Nci60_008280 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H13Br2N3O2 |
| Molecular Weight | 463.13 |
| CAS Registry Number | 105372-81-4 |
| SMILES | C5=C2C1=C(C(C4=C(C1=NCC2)C3(C=C(Br)C(C(=C3)Br)=O)CCN4)=O)[NH]5 |
| InChI | 1S/C18H13Br2N3O2/c19-9-5-18(6-10(20)16(9)24)2-4-22-15-12(18)13-11-8(1-3-21-13)7-23-14(11)17(15)25/h5-7,22-23H,1-4H2 |
| InChIKey | IWHQWCUADMOONN-UHFFFAOYSA-N |
| Density | 2.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 716.956°C at 760 mmHg (Cal.) |
| Flash point | 387.401°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dibromo-2',3',5',7',8',9'-hexahydro-Spiro[2,5-cyclohexadiene-1,10'(6'H)-pyrrolo[4,3,2-de][1,7]phenanthroline]-4,6'-dione |