|
CAS#: 10540-97-3 Product: Memotine Hydrochloride No suppilers available for the product. |
| Name | Memotine Hydrochloride |
|---|---|
| Synonyms | D04906; Memotine Hydrochloride (Usan); 3,4-Dihydro-1-[(P-Methoxyphenoxy)Methyl]Isoquinoline Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.79 |
| CAS Registry Number | 10540-97-3 |
| SMILES | [H+].C2=C1CCN=C(C1=CC=C2)COC3=CC=C(OC)C=C3.[Cl-] |
| InChI | 1S/C17H17NO2.ClH/c1-19-14-6-8-15(9-7-14)20-12-17-16-5-3-2-4-13(16)10-11-18-17;/h2-9H,10-12H2,1H3;1H |
| InChIKey | LFFGEYHTAJZONR-UHFFFAOYSA-N |
| Boiling point | 423°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 168.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Memotine Hydrochloride |