Online Database of Chemicals from Around the World
|
CAS#: 10546-24-4 Product: 3-Methyl-2-Naphthylamine No suppilers available for the product. |
| Name | 3-Methyl-2-Naphthylamine |
|---|---|
| Synonyms | (3-Methyl-2-Naphthyl)Ammonium Chloride; 2-Naphthylamine, 3-Methyl-, Hydrochloride; 3-Methyl-2-Naphthylamine, Hydrochloride |
| Molecular Structure |  |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 |
| CAS Registry Number | 10546-24-4 (5096-18-4) |
| SMILES | C1=C(C(=CC2=C1C=CC=C2)[NH3+])C.[Cl-] |
| InChI | 1S/C11H11N.ClH/c1-8-6-9-4-2-3-5-10(9)7-11(8)12;/h2-7H,12H2,1H3;1H |
| InChIKey | VBKWOFQKNFMGPR-UHFFFAOYSA-N |
| Boiling point | 318.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 161.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-2-Naphthylamine |