|
CAS#: 1055-75-0 Product: Venenatine No suppilers available for the product. |
| Name | Venenatine |
|---|---|
| Synonyms | Nsc 339139; Venenatine; Yohimban-16-Carboxylic Acid, 17-Hydroxy-9-Methoxy-, Methyl Ester, (3-Beta,16-Beta,17-Beta,20-Alpha)- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.47 |
| CAS Registry Number | 1055-75-0 |
| SMILES | [C@@H]34C1=C(C2=C([NH]1)C=CC=C2OC)CCN3C[C@@H]5[C@H](C4)[C@H](C(=O)OC)[C@@H](CC5)O |
| InChI | 1S/C22H28N2O4/c1-27-18-5-3-4-15-19(18)13-8-9-24-11-12-6-7-17(25)20(22(26)28-2)14(12)10-16(24)21(13)23-15/h3-5,12,14,16-17,20,23,25H,6-11H2,1-2H3/t12-,14+,16-,17-,20+/m1/s1 |
| InChIKey | WMMZYEBFJWWUJX-YCSGKXEJSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 571.283°C at 760 mmHg (Cal.) |
| Flash point | 299.301°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Venenatine |