Online Database of Chemicals from Around the World
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (650) 278-9963 | |||
 |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 1-Phenethyl-2-Picolinium Bromide |
|---|---|
| Synonyms | 2-Methyl-1-Phenethyl-Pyridin-1-Ium Bromide; .Alpha.-Picolinium-.Beta.-Phenylethyl Bromide; 1-Phenethyl-2-Picolinium Bromide |
| Molecular Structure |  |
| Molecular Formula | C14H16BrN |
| Molecular Weight | 278.19 |
| CAS Registry Number | 10551-21-0 |
| EINECS | 234-134-8 |
| SMILES | C1=CC=CC(=[N+]1CCC2=CC=CC=C2)C.[Br-] |
| InChI | 1S/C14H16N.BrH/c1-13-7-5-6-11-15(13)12-10-14-8-3-2-4-9-14;/h2-9,11H,10,12H2,1H3;1H/q+1;/p-1 |
| InChIKey | AYHBRSKXFVQPPX-UHFFFAOYSA-M |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Phenethyl-2-Picolinium Bromide |