|
CAS#: 105544-39-6 Product: 6-Chloro-1H-Pyrido[2,3-b][1,4]Oxazin-2(3H)-One No suppilers available for the product. |
| Name | 6-Chloro-1H-Pyrido[2,3-b][1,4]Oxazin-2(3H)-One |
|---|---|
| Synonyms | 7-CHLORO-2H-PYRIDO[2,3-B]-1,4-OXAZIN-3(4H)-ONE |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5ClN2O2 |
| Molecular Weight | 184.58 |
| CAS Registry Number | 105544-39-6 |
| SMILES | C1C(=O)NC2=C(O1)N=C(C=C2)Cl |
| InChI | 1S/C7H5ClN2O2/c8-5-2-1-4-7(10-5)12-3-6(11)9-4/h1-2H,3H2,(H,9,11) |
| InChIKey | QZCXKQHUJLFAAJ-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 204.1±28.7°C (Cal.) |
| Refractive index | 1.585 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-1H-Pyrido[2,3-b][1,4]Oxazin-2(3H)-One |