Online Database of Chemicals from Around the World
|
CAS#: 1057-86-9 Product: 1-(4-Fluorophenyl)-4-[4-(2-Methoxyphenyl)-1-Piperazinyl]-1-Butanone Phosphate (1:1) No suppilers available for the product. |
| Name | 1-(4-Fluorophenyl)-4-[4-(2-Methoxyphenyl)-1-Piperazinyl]-1-Butanone Phosphate (1:1) |
|---|---|
| Synonyms | 4'-fluoro |
| Molecular Structure | ![CAS#: 1057-86-9, 1-(4-Fluorophenyl)-4-[4-(2-Methoxyphenyl)-1-Piperazinyl]-1-Butanone Phosphate (1:1)](/moreStructures/1057-86-9.gif) |
| Molecular Formula | C21H28FN2O6P |
| Molecular Weight | 454.43 |
| CAS Registry Number | 1057-86-9 |
| EINECS | 213-893-9 |
| SMILES | OP(O)(O)=O.Fc1ccc(cc1)C(=O)CCCN2CCN(CC2)c3ccccc3OC |
| InChI | 1S/C21H25FN2O2.H3O4P/c1-26-21-7-3-2-5-19(21)24-15-13-23(14-16-24)12-4-6-20(25)17-8-10-18(22)11-9-17;1-5(2,3)4/h2-3,5,7-11H,4,6,12-16H2,1H3;(H3,1,2,3,4) |
| InChIKey | ZOJCVJVTZBRZQU-UHFFFAOYSA-N |
| Boiling point | 692°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 372.3°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Fluorophenyl)-4-[4-(2-Methoxyphenyl)-1-Piperazinyl]-1-Butanone Phosphate (1:1) |