|
CAS#: 10582-48-6 Product: 3-Hydroxy-6-(3-ketobutyl)-3a-methyl-2,3,4,5,5a,6,8,9,9a,9b-decahydro-1H-cyclopenta[f]naphthalen-7-one No suppilers available for the product. |
| Name | 3-Hydroxy-6-(3-ketobutyl)-3a-methyl-2,3,4,5,5a,6,8,9,9a,9b-decahydro-1H-cyclopenta[f]naphthalen-7-one |
|---|---|
| Synonyms | 3-Hydroxy-6-(3-Ketobutyl)-3A-Methyl-2,3,4,5,5A,6,8,9,9A,9B-Decahydro-1H-Cyclopenta[F]Naphthalen-7-One; 17-Beta-Hydroxy-4,5-Secooestrane-3,5-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 |
| CAS Registry Number | 10582-48-6 |
| EINECS | 234-184-0 |
| SMILES | C(C3C1C(C2C(CC1)(C(CC2)O)C)CCC3=O)CC(=O)C |
| InChI | 1S/C18H28O3/c1-11(19)3-4-14-12-9-10-18(2)15(6-8-17(18)21)13(12)5-7-16(14)20/h12-15,17,21H,3-10H2,1-2H3 |
| InChIKey | IUVFRVBMKOCTCP-UHFFFAOYSA-N |
| Density | 1.089g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.303°C at 760 mmHg (Cal.) |
| Flash point | 231.805°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-6-(3-ketobutyl)-3a-methyl-2,3,4,5,5a,6,8,9,9a,9b-decahydro-1H-cyclopenta[f]naphthalen-7-one |