|
CAS#: 105864-79-7 Product: (Bis(2,2,2-Trifluoroethyl)Amino)Methanedithioic Acid No suppilers available for the product. |
| Name | (Bis(2,2,2-Trifluoroethyl)Amino)Methanedithioic Acid |
|---|---|
| Synonyms | Carbamodithioic Acid, Bis(Trifluoroethyl)-; Lithium Bis(Trifluoroethyl)Dithiocarbamate; Btca |
| Molecular Structure | ![]() |
| Molecular Formula | C5H5F6NS2 |
| Molecular Weight | 257.21 |
| CAS Registry Number | 105864-79-7 |
| SMILES | C(N(C(S)=S)CC(F)(F)F)C(F)(F)F |
| InChI | 1S/C5H5F6NS2/c6-4(7,8)1-12(3(13)14)2-5(9,10)11/h1-2H2,(H,13,14) |
| InChIKey | WPMVTNXZTFLSJU-UHFFFAOYSA-N |
| Density | 1.512g/cm3 (Cal.) |
|---|---|
| Boiling point | 154.974°C at 760 mmHg (Cal.) |
| Flash point | 47.527°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Bis(2,2,2-Trifluoroethyl)Amino)Methanedithioic Acid |