|
CAS#: 10605-24-0 Product: 2-Methyl-2-Propylpropane-1,3-Diyl Dinitrate No suppilers available for the product. |
| Name | 2-Methyl-2-Propylpropane-1,3-Diyl Dinitrate |
|---|---|
| Synonyms | Nitric Acid [2-Methyl-2-(Nitrooxymethyl)Pentyl] Ester; 2-Methyl-2-Propylpropane-1,3-Diyl Dinitrate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H14N2O6 |
| Molecular Weight | 222.20 |
| CAS Registry Number | 10605-24-0 |
| EINECS | 234-233-6 |
| SMILES | C(O[N+]([O-])=O)C(CO[N+]([O-])=O)(CCC)C |
| InChI | 1S/C7H14N2O6/c1-3-4-7(2,5-14-8(10)11)6-15-9(12)13/h3-6H2,1-2H3 |
| InChIKey | BLJBDLGFKNXUCB-UHFFFAOYSA-N |
| Density | 1.218g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.454°C at 760 mmHg (Cal.) |
| Flash point | 115.497°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propylpropane-1,3-Diyl Dinitrate |