|
CAS#: 106072-73-5 Product: 6-Fluoro-1,2,3a,4-Tetrahydrofuro[2,3-b]Indol-8B-Ol No suppilers available for the product. |
| Name | 6-Fluoro-1,2,3a,4-Tetrahydrofuro[2,3-b]Indol-8B-Ol |
|---|---|
| Synonyms | 3Alpha-Hydroxy-6-Fluoroindoline |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 |
| CAS Registry Number | 106072-73-5 |
| SMILES | C1=CC(=CC2=C1C3(C(N2)OCC3)O)F |
| InChI | 1S/C10H10FNO2/c11-6-1-2-7-8(5-6)12-9-10(7,13)3-4-14-9/h1-2,5,9,12-13H,3-4H2 |
| InChIKey | APUSQTYVAFAQFR-UHFFFAOYSA-N |
| Density | 1.437g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.575°C at 760 mmHg (Cal.) |
| Flash point | 166.427°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Fluoro-1,2,3a,4-Tetrahydrofuro[2,3-b]Indol-8B-Ol |