|
CAS#: 106386-94-1 Product: Viguiepenol No suppilers available for the product. |
| Name | Viguiepenol |
|---|---|
| Synonyms | (2R,4Ar,7R,8As,10As)-1,1,4A,7-Tetramethyl-7-Vinyl-3,4,6,8,8A,9,10,10A-Octahydro-2H-Phenanthren-2-Ol; 3R,5R,8S,10R,13R-Entpimara-9(11),15-Dien-3-Alpha-Ol; Viguiepenol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 |
| CAS Registry Number | 106386-94-1 |
| SMILES | [C@@H]1(C([C@@H]3[C@@](CC1)(C2=CC[C@@](C[C@@H]2CC3)(C)C=C)C)(C)C)O |
| InChI | 1S/C20H32O/c1-6-19(4)11-9-15-14(13-19)7-8-16-18(2,3)17(21)10-12-20(15,16)5/h6,9,14,16-17,21H,1,7-8,10-13H2,2-5H3/t14-,16+,17+,19+,20-/m0/s1 |
| InChIKey | HPFBDDHVNYWUGF-UZKILMIQSA-N |
| Density | 0.994g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.962°C at 760 mmHg (Cal.) |
| Flash point | 161.715°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Viguiepenol |